Products 1439898-27-7
CAS 1439898-27-7 appears in our catalog under these names: 1-(2-Fluorobenzyl)-1h-imidazole-2-carboxylic acid, 95%, 1-(2-Fluorobenzyl)-1H-imidazole-2-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg.
1-[(2-fluorophenyl)methyl]imidazole-2-carboxylic acid (CAS 1439898-27-7) is a chemical compound with the molecular formula C11H9FN2O2 and a molecular weight of 220.20 g/mol. IUPAC name: 1-[(2-fluorophenyl)methyl]imidazole-2-carboxylic acid. InChIKey: SJQMCIQETZDTMW-UHFFFAOYSA-N.
| Molecular formula | C11H9FN2O2 |
|---|---|
| Molecular weight | 220.20 g/mol |
| IUPAC name | 1-[(2-fluorophenyl)methyl]imidazole-2-carboxylic acid |
| InChIKey | SJQMCIQETZDTMW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CN2C=CN=C2C(=O)O)F |
Computed by PubChem (NCBI)