cas: 1227628-83-2 — see every product listed under this CAS number, including other names
2-Fluoro-4-(trifluoromethoxy)benzaldehyde, 97% (CAS 1227628-83-2) is a chemical reagent available from Chemat. Available pack sizes: 25g, 1g, 5g, 10g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A256696-25g |
| cas | 1227628-83-2 |
| size | 25g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 25g | 21142.87 Pln | |
| Fluorochem | 1g | 487.35 Pln | |
| Fluorochem | 5g | 1408.90 Pln | |
| Fluorochem | 10g | 2601.19 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-fluoro-4-(trifluoromethoxy)benzaldehyde (CAS 1227628-83-2) is a chemical compound with the molecular formula C8H4F4O2 and a molecular weight of 208.11 g/mol. IUPAC name: 2-fluoro-4-(trifluoromethoxy)benzaldehyde. InChIKey: DEACWPDDLIOZJV-UHFFFAOYSA-N.
| Molecular formula | C8H4F4O2 |
|---|---|
| Molecular weight | 208.11 g/mol |
| IUPAC name | 2-fluoro-4-(trifluoromethoxy)benzaldehyde |
| InChIKey | DEACWPDDLIOZJV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1OC(F)(F)F)F)C=O |
Computed by PubChem (NCBI)