cas: 207853-64-3 — see every product listed under this CAS number, including other names
2-Fluoro-4-(trifluoromethyl)benzamide, 98%, 98% (CAS 207853-64-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113JBZ-250mg |
| cas | 207853-64-3 |
| size | 250mg |
| availability | 300g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 107.60 Pln | |
| Chemat | 5g | 218.00 Pln | |
| Chemat | 10g | 338.00 Pln | |
| Chemat | 25g | 755.60 Pln | |
| Chemat | 100g | 2766.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-fluoro-4-(trifluoromethyl)benzamide (CAS 207853-64-3) is a chemical compound with the molecular formula C8H5F4NO and a molecular weight of 207.12 g/mol. IUPAC name: 2-fluoro-4-(trifluoromethyl)benzamide. InChIKey: BQNZIRSNAKWERJ-UHFFFAOYSA-N.
| Molecular formula | C8H5F4NO |
|---|---|
| Molecular weight | 207.12 g/mol |
| IUPAC name | 2-fluoro-4-(trifluoromethyl)benzamide |
| InChIKey | BQNZIRSNAKWERJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)F)C(=O)N |
Computed by PubChem (NCBI)