Products 1844922-78-6
CAS 1844922-78-6 is the registry number for N-[4-Fluoro-2-(trifluoromethyl)phenyl]formamide, 97%. Offered by: Combi-blocks, Chemat Brand. Available pack sizes: 1g, 5g, on request.
N-[4-fluoro-2-(trifluoromethyl)phenyl]formamide (CAS 1844922-78-6) is a chemical compound with the molecular formula C8H5F4NO and a molecular weight of 207.12 g/mol. IUPAC name: N-[4-fluoro-2-(trifluoromethyl)phenyl]formamide. InChIKey: FYLVJCZVGHHIEJ-UHFFFAOYSA-N.
| Molecular formula | C8H5F4NO |
|---|---|
| Molecular weight | 207.12 g/mol |
| IUPAC name | N-[4-fluoro-2-(trifluoromethyl)phenyl]formamide |
| InChIKey | FYLVJCZVGHHIEJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)C(F)(F)F)NC=O |
Computed by PubChem (NCBI)