2-Fluoro-4-iodo-6-nitroaniline, 98%
cas: 517920-73-9 — see every product listed under this CAS number, including other names
2-Fluoro-4-iodo-6-nitroaniline, 98% (CAS 517920-73-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F064697-250MG |
| cas | 517920-73-9 |
| size | 250mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 180.16 Pln | |
| Fluorochem | 1g | 331.15 Pln | |
| Fluorochem | 5g | 1174.60 Pln | |
| Ambeed | 100mg | 153.44 Pln | |
| Ambeed | 250mg | 186.81 Pln | |
| Ambeed | 1g | 331.44 Pln | |
| Ambeed | 5g | 1138.00 Pln | |
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 250mg | 107.60 Pln | |
| Chemat | 1g | 246.80 Pln | |
| BLDpharm | 100mg | 158.86 Pln | |
| BLDpharm | 250mg | 197.73 Pln | |
| BLDpharm | 1g | 347.68 Pln | |
| BLDpharm | 5g | 1225.15 Pln |
properties
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
2-fluoro-4-iodo-6-nitroaniline (CAS 517920-73-9) is a chemical compound with the molecular formula C6H4FIN2O2 and a molecular weight of 282.01 g/mol. IUPAC name: 2-fluoro-4-iodo-6-nitroaniline. InChIKey: YXIIZLLZNKTXHB-UHFFFAOYSA-N.
| Molecular formula | C6H4FIN2O2 |
|---|---|
| Molecular weight | 282.01 g/mol |
| IUPAC name | 2-fluoro-4-iodo-6-nitroaniline |
| InChIKey | YXIIZLLZNKTXHB-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1[N+](=O)[O-])N)F)I |
Computed by PubChem (NCBI)