CAS 153505-44-3 is the registry number for 4-Fluoro-2-iodo-6-nitroaniline, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g.
4-fluoro-2-iodo-6-nitroaniline (CAS 153505-44-3) is a chemical compound with the molecular formula C6H4FIN2O2 and a molecular weight of 282.01 g/mol. IUPAC name: 4-fluoro-2-iodo-6-nitroaniline. InChIKey: SPBHPTFZEAUROH-UHFFFAOYSA-N.
| Molecular formula | C6H4FIN2O2 |
|---|---|
| Molecular weight | 282.01 g/mol |
| IUPAC name | 4-fluoro-2-iodo-6-nitroaniline |
| InChIKey | SPBHPTFZEAUROH-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1[N+](=O)[O-])N)I)F |
Computed by PubChem (NCBI)