CAS 1955534-80-1 is the registry number for 3–Fluoro–6–iodo–2–nitroaniline. Offered by: GLPBio. Available pack sizes: 100mg.
3-fluoro-6-iodo-2-nitroaniline (CAS 1955534-80-1) is a chemical compound with the molecular formula C6H4FIN2O2 and a molecular weight of 282.01 g/mol. IUPAC name: 3-fluoro-6-iodo-2-nitroaniline. InChIKey: WYXIWLUMYMXFNK-UHFFFAOYSA-N.
| Molecular formula | C6H4FIN2O2 |
|---|---|
| Molecular weight | 282.01 g/mol |
| IUPAC name | 3-fluoro-6-iodo-2-nitroaniline |
| InChIKey | WYXIWLUMYMXFNK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1F)[N+](=O)[O-])N)I |
Computed by PubChem (NCBI)