CAS 2091144-90-8 is the registry number for 2-Fluoro-6-iodo-4-nitroaniline, 98%. Offered by: AmBeed. Available pack sizes: 25g.
2-fluoro-6-iodo-4-nitroaniline (CAS 2091144-90-8) is a chemical compound with the molecular formula C6H4FIN2O2 and a molecular weight of 282.01 g/mol. IUPAC name: 2-fluoro-6-iodo-4-nitroaniline. InChIKey: GJTOPFHTCCIELI-UHFFFAOYSA-N.
| Molecular formula | C6H4FIN2O2 |
|---|---|
| Molecular weight | 282.01 g/mol |
| IUPAC name | 2-fluoro-6-iodo-4-nitroaniline |
| InChIKey | GJTOPFHTCCIELI-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)N)I)[N+](=O)[O-] |
Computed by PubChem (NCBI)