CAS 1219741-86-2 appears in our catalog under these names: 5-Fluoro-4-iodo-2-nitroaniline, 95%, 5-Fluoro-4-iodo-2-nitroaniline 95%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 1g, 5g, 250mg.
5-fluoro-4-iodo-2-nitroaniline (CAS 1219741-86-2) is a chemical compound with the molecular formula C6H4FIN2O2 and a molecular weight of 282.01 g/mol. IUPAC name: 5-fluoro-4-iodo-2-nitroaniline. InChIKey: VYUKTTWGCYDBIV-UHFFFAOYSA-N.
| Molecular formula | C6H4FIN2O2 |
|---|---|
| Molecular weight | 282.01 g/mol |
| IUPAC name | 5-fluoro-4-iodo-2-nitroaniline |
| InChIKey | VYUKTTWGCYDBIV-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)I)[N+](=O)[O-])N |
Computed by PubChem (NCBI)