cas: 19346-43-1 — see every product listed under this CAS number, including other names
2-Fluoro-4-methyl-3-nitropyridine, 98% (CAS 19346-43-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F036175-1G |
| cas | 19346-43-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 190.58 Pln | |
| Fluorochem | 5g | 581.06 Pln | |
| Fluorochem | 10g | 1034.03 Pln | |
| Fluorochem | 25g | 2101.36 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
2-fluoro-4-methyl-3-nitropyridine (CAS 19346-43-1) is a chemical compound with the molecular formula C6H5FN2O2 and a molecular weight of 156.11 g/mol. IUPAC name: 2-fluoro-4-methyl-3-nitropyridine. InChIKey: AUHFWLUBEJKXLN-UHFFFAOYSA-N.
| Molecular formula | C6H5FN2O2 |
|---|---|
| Molecular weight | 156.11 g/mol |
| IUPAC name | 2-fluoro-4-methyl-3-nitropyridine |
| InChIKey | AUHFWLUBEJKXLN-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NC=C1)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)