cas: 19346-43-1 — see every product listed under this CAS number, including other names
2-fluoro-3-nitro-4-picoline, 98%, 98% (CAS 19346-43-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11843Y-100mg |
| cas | 19346-43-1 |
| size | 100mg |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 136.40 Pln | |
| Chemat | 5g | 366.80 Pln | |
| Chemat | 10g | 669.20 Pln | |
| Chemat | 25g | 1278.80 Pln | |
| Chemat | 100g | 4048.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-fluoro-4-methyl-3-nitropyridine (CAS 19346-43-1) is a chemical compound with the molecular formula C6H5FN2O2 and a molecular weight of 156.11 g/mol. IUPAC name: 2-fluoro-4-methyl-3-nitropyridine. InChIKey: AUHFWLUBEJKXLN-UHFFFAOYSA-N.
| Molecular formula | C6H5FN2O2 |
|---|---|
| Molecular weight | 156.11 g/mol |
| IUPAC name | 2-fluoro-4-methyl-3-nitropyridine |
| InChIKey | AUHFWLUBEJKXLN-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NC=C1)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)