Products 170981-26-7

CAS 170981-26-7 appears in our catalog under these names: 2-Fluoro-4-methylphenylboronic acid, 98%, 2-Fluoro-4-methylphenylboronic Acid, >95% (HPLC), 2–Fluoro–4–methylphenylboronic acid(contains varying amounts of Anhydride), 2-Fluoro-4-methylphenylboronic acid/ 95+%, 2-Fluoro-4-methylphenylboronic Acid (contains varying amounts of Anhydride). Offered by: Combi-blocks, TRC, GLPBio, Chemat, TCI. Available pack sizes: 5g, 25g, 100g, 1g, 10g.

Structural formula: {0} (CAS {1})

(2-fluoro-4-methylphenyl)boronic acid (CAS 170981-26-7) is a chemical compound with the molecular formula C7H8BFO2 and a molecular weight of 153.95 g/mol. IUPAC name: (2-fluoro-4-methylphenyl)boronic acid. InChIKey: LIXXGOMAGHXIMP-UHFFFAOYSA-N.

Identity
Molecular formulaC7H8BFO2
Molecular weight153.95 g/mol
IUPAC name(2-fluoro-4-methylphenyl)boronic acid
InChIKeyLIXXGOMAGHXIMP-UHFFFAOYSA-N
SMILESB(C1=C(C=C(C=C1)C)F)(O)O

Computed by PubChem (NCBI)