2-Fluoro-5-(Trifluoromethoxy)Benzaldehyde, 97%, 97%
cas: 886497-81-0 — see every product listed under this CAS number, including other names
2-Fluoro-5-(Trifluoromethoxy)Benzaldehyde, 97%, 97% (CAS 886497-81-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1144B0-250mg |
| cas | 886497-81-0 |
| size | 250mg |
| availability | 200g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 93.20 Pln | |
| Chemat | 5g | 203.60 Pln | |
| Chemat | 10g | 323.60 Pln | |
| Chemat | 25g | 659.60 Pln | |
| Chemat | 100g | 2272.40 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-fluoro-5-(trifluoromethoxy)benzaldehyde (CAS 886497-81-0) is a chemical compound with the molecular formula C8H4F4O2 and a molecular weight of 208.11 g/mol. IUPAC name: 2-fluoro-5-(trifluoromethoxy)benzaldehyde. InChIKey: FMDGCHMPSCBYFX-UHFFFAOYSA-N.
| Molecular formula | C8H4F4O2 |
|---|---|
| Molecular weight | 208.11 g/mol |
| IUPAC name | 2-fluoro-5-(trifluoromethoxy)benzaldehyde |
| InChIKey | FMDGCHMPSCBYFX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1OC(F)(F)F)C=O)F |
Computed by PubChem (NCBI)