2-Fluoro-5-(trifluoromethoxy)benzaldehyde 95%
cas: 886497-81-0 — see every product listed under this CAS number, including other names
2-Fluoro-5-(trifluoromethoxy)benzaldehyde 95% (CAS 886497-81-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A221134-1g |
| cas | 886497-81-0 |
| size | 1g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 136.75 Pln | |
| Ambeed | 5g | 281.38 Pln | |
| Ambeed | 10g | 403.75 Pln | |
| Ambeed | 25g | 782.00 Pln | |
| Ambeed | 100g | 2806.75 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A221134 |
2-fluoro-5-(trifluoromethoxy)benzaldehyde (CAS 886497-81-0) is a chemical compound with the molecular formula C8H4F4O2 and a molecular weight of 208.11 g/mol. IUPAC name: 2-fluoro-5-(trifluoromethoxy)benzaldehyde. InChIKey: FMDGCHMPSCBYFX-UHFFFAOYSA-N.
| Molecular formula | C8H4F4O2 |
|---|---|
| Molecular weight | 208.11 g/mol |
| IUPAC name | 2-fluoro-5-(trifluoromethoxy)benzaldehyde |
| InChIKey | FMDGCHMPSCBYFX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1OC(F)(F)F)C=O)F |
Computed by PubChem (NCBI)