cas: 207919-05-9 — see every product listed under this CAS number, including other names
2-Fluoro-5-(trifluoromethyl)benzamide (CAS 207919-05-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F006389-1G |
| cas | 207919-05-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 227.02 Pln | |
| Fluorochem | 5g | 883.04 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | no data |
2-fluoro-5-(trifluoromethyl)benzamide (CAS 207919-05-9) is a chemical compound with the molecular formula C8H5F4NO and a molecular weight of 207.12 g/mol. IUPAC name: 2-fluoro-5-(trifluoromethyl)benzamide. InChIKey: DDLPGTOHZZKQLP-UHFFFAOYSA-N.
| Molecular formula | C8H5F4NO |
|---|---|
| Molecular weight | 207.12 g/mol |
| IUPAC name | 2-fluoro-5-(trifluoromethyl)benzamide |
| InChIKey | DDLPGTOHZZKQLP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)C(=O)N)F |
Computed by PubChem (NCBI)