cas: 865663-98-5 — see every product listed under this CAS number, including other names
2-Fluoro-5-methanesulfonyl-benzoic acid methyl ester, 98% (CAS 865663-98-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 500mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F475772-100MG |
| cas | 865663-98-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 1060.06 Pln | |
| Fluorochem | 500mg | 3278.03 Pln | |
| Fluorochem | 1g | 5277.33 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 2-fluoro-5-methylsulfonylbenzoate (CAS 865663-98-5) is a chemical compound with the molecular formula C9H9FO4S and a molecular weight of 232.23 g/mol. IUPAC name: methyl 2-fluoro-5-methylsulfonylbenzoate. InChIKey: HULWANKRMSPEGN-UHFFFAOYSA-N.
| Molecular formula | C9H9FO4S |
|---|---|
| Molecular weight | 232.23 g/mol |
| IUPAC name | methyl 2-fluoro-5-methylsulfonylbenzoate |
| InChIKey | HULWANKRMSPEGN-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1)S(=O)(=O)C)F |
Computed by PubChem (NCBI)