cas: 865663-98-5 — see every product listed under this CAS number, including other names
Methyl 2-fluoro-5-(methylsulfonyl)benzoate 95% (CAS 865663-98-5) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A213552-50mg |
| cas | 865663-98-5 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 904.38 Pln | |
| Ambeed | 100mg | 1460.62 Pln | |
| Ambeed | 250mg | 2445.19 Pln | |
| Ambeed | 1g | 4809.25 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A213552 |
Methyl 2-fluoro-5-methylsulfonylbenzoate (CAS 865663-98-5) is a chemical compound with the molecular formula C9H9FO4S and a molecular weight of 232.23 g/mol. IUPAC name: methyl 2-fluoro-5-methylsulfonylbenzoate. InChIKey: HULWANKRMSPEGN-UHFFFAOYSA-N.
| Molecular formula | C9H9FO4S |
|---|---|
| Molecular weight | 232.23 g/mol |
| IUPAC name | methyl 2-fluoro-5-methylsulfonylbenzoate |
| InChIKey | HULWANKRMSPEGN-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1)S(=O)(=O)C)F |
Computed by PubChem (NCBI)