cas: 865663-98-5 — see every product listed under this CAS number, including other names
Methyl 2-Fluoro-5-(methylsulfonyl)benzoate, 95%, 95% (CAS 865663-98-5) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11GU2Q-50mg |
| cas | 865663-98-5 |
| size | 50mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 698.00 Pln | |
| Chemat | 100mg | 1125.20 Pln | |
| Chemat | 250mg | 1878.80 Pln | |
| Chemat | 500mg | 2555.60 Pln | |
| Chemat | 1g | 3698.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Methyl 2-fluoro-5-methylsulfonylbenzoate (CAS 865663-98-5) is a chemical compound with the molecular formula C9H9FO4S and a molecular weight of 232.23 g/mol. IUPAC name: methyl 2-fluoro-5-methylsulfonylbenzoate. InChIKey: HULWANKRMSPEGN-UHFFFAOYSA-N.
| Molecular formula | C9H9FO4S |
|---|---|
| Molecular weight | 232.23 g/mol |
| IUPAC name | methyl 2-fluoro-5-methylsulfonylbenzoate |
| InChIKey | HULWANKRMSPEGN-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1)S(=O)(=O)C)F |
Computed by PubChem (NCBI)