cas: 452972-14-4 — see every product listed under this CAS number, including other names
2-Fluoropyridine-3-boronic acid pinacol ester, 98% (CAS 452972-14-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F219480-1G |
| cas | 452972-14-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 96.86 Pln | |
| Fluorochem | 5g | 154.13 Pln | |
| Fluorochem | 10g | 206.20 Pln | |
| Fluorochem | 25g | 351.98 Pln | |
| Fluorochem | 100g | 1226.67 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
2-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 452972-14-4) is a chemical compound with the molecular formula C11H15BFNO2 and a molecular weight of 223.05 g/mol. IUPAC name: 2-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: YYOZFGQOPNTVGM-UHFFFAOYSA-N.
| Molecular formula | C11H15BFNO2 |
|---|---|
| Molecular weight | 223.05 g/mol |
| IUPAC name | 2-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | YYOZFGQOPNTVGM-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(N=CC=C2)F |
Computed by PubChem (NCBI)