CAS 1333394-28-7 appears in our catalog under these names: (3-fluoro-4-(pyrrolidin-1-ylmethyl)phenyl)boronic acid, 95+%, 3–Fluoro–4–(pyrrolidin–1–ylmethyl)phenylboronic acid. Offered by: AmBeed, GLPBio. Available pack sizes: 5g, 1g.
[3-fluoro-4-(pyrrolidin-1-ylmethyl)phenyl]boronic acid (CAS 1333394-28-7) is a chemical compound with the molecular formula C11H15BFNO2 and a molecular weight of 223.05 g/mol. IUPAC name: [3-fluoro-4-(pyrrolidin-1-ylmethyl)phenyl]boronic acid. InChIKey: OIPNJXOFGDSWGK-UHFFFAOYSA-N.
| Molecular formula | C11H15BFNO2 |
|---|---|
| Molecular weight | 223.05 g/mol |
| IUPAC name | [3-fluoro-4-(pyrrolidin-1-ylmethyl)phenyl]boronic acid |
| InChIKey | OIPNJXOFGDSWGK-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)CN2CCCC2)F)(O)O |
Computed by PubChem (NCBI)