cas: 458532-86-0 — see every product listed under this CAS number, including other names
2-Fluoropyridine-4-boronic acid pinacol ester, 95% (CAS 458532-86-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Thermo Scientific (Acros), Fluorochem.
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 435930010 |
| cas | 458532-86-0 |
| size | 1g |
| availability | availability |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 1g | 650.35 Pln | |
| Thermo Scientific (Acros) | 5g | 2008.96 Pln | |
| Fluorochem | 1g | 107.27 Pln | |
| Fluorochem | 5g | 227.02 Pln | |
| Fluorochem | 10g | 383.22 Pln | |
| Fluorochem | 25g | 679.99 Pln | |
| Fluorochem | 100g | 2507.47 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 95% |
2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 458532-86-0) is a chemical compound with the molecular formula C11H15BFNO2 and a molecular weight of 223.05 g/mol. IUPAC name: 2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: PCLMNCBIXQQRMB-UHFFFAOYSA-N.
| Molecular formula | C11H15BFNO2 |
|---|---|
| Molecular weight | 223.05 g/mol |
| IUPAC name | 2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | PCLMNCBIXQQRMB-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=NC=C2)F |
Computed by PubChem (NCBI)