cas: 444120-95-0 — see every product listed under this CAS number, including other names
2-Fluoropyridine-5-boronic acid pinacol ester, 99.37% (CAS 444120-95-0) is a chemical reagent available from Chemat. Available pack sizes: 5 g, 10 g, 25 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W012386-5 g |
| cas | 444120-95-0 |
| size | 5 g |
| availability | Get quote |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 5 g | 240.74 Pln | |
| MedChemExpress | 10 g | 287.18 Pln | |
| MedChemExpress | 25 g | 361.49 Pln |
| delivery time | over 3 weeks |
|---|---|
| purity | 99.37% |
2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 444120-95-0) is a chemical compound with the molecular formula C11H15BFNO2 and a molecular weight of 223.05 g/mol. IUPAC name: 2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: ZKSRQMCKFLGPQU-UHFFFAOYSA-N.
| Molecular formula | C11H15BFNO2 |
|---|---|
| Molecular weight | 223.05 g/mol |
| IUPAC name | 2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | ZKSRQMCKFLGPQU-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(C=C2)F |
Computed by PubChem (NCBI)