cas: 40138-17-8 — see every product listed under this CAS number, including other names
2-Formyl-5-methylphenylboronic acid, 95% (CAS 40138-17-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F219486-250MG |
| cas | 40138-17-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 164.54 Pln | |
| Fluorochem | 1g | 289.50 Pln | |
| Fluorochem | 5g | 1112.13 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
(2-formyl-5-methylphenyl)boronic acid (CAS 40138-17-8) is a chemical compound with the molecular formula C8H9BO3 and a molecular weight of 163.97 g/mol. IUPAC name: (2-formyl-5-methylphenyl)boronic acid. InChIKey: MMKCZTKFYDEERR-UHFFFAOYSA-N.
| Molecular formula | C8H9BO3 |
|---|---|
| Molecular weight | 163.97 g/mol |
| IUPAC name | (2-formyl-5-methylphenyl)boronic acid |
| InChIKey | MMKCZTKFYDEERR-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)C)C=O)(O)O |
Computed by PubChem (NCBI)