2-Formyl-5-methylphenylboronic acid, 96%, 96%
cas: 40138-17-8 — see every product listed under this CAS number, including other names
2-Formyl-5-methylphenylboronic acid, 96%, 96% (CAS 40138-17-8) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114HCB-10g |
| cas | 40138-17-8 |
| size | 10g |
| availability | 20g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 1456.40 Pln | |
| Chemat | 100mg | 93.20 Pln | |
| Chemat | 250mg | 136.40 Pln | |
| Chemat | 1g | 246.80 Pln | |
| Chemat | 5g | 933.20 Pln |
properties
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
(2-formyl-5-methylphenyl)boronic acid (CAS 40138-17-8) is a chemical compound with the molecular formula C8H9BO3 and a molecular weight of 163.97 g/mol. IUPAC name: (2-formyl-5-methylphenyl)boronic acid. InChIKey: MMKCZTKFYDEERR-UHFFFAOYSA-N.
| Molecular formula | C8H9BO3 |
|---|---|
| Molecular weight | 163.97 g/mol |
| IUPAC name | (2-formyl-5-methylphenyl)boronic acid |
| InChIKey | MMKCZTKFYDEERR-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)C)C=O)(O)O |
Computed by PubChem (NCBI)
Synonyms:
B-(2-Formyl-5-methylphenyl)boronic acid, 2-Formyl-5-methylphenylboronic acid, (2-formyl-5-methylphenyl)boronic acid, (2-formyl-5-methyl-phenyl)boronic Acid, 2-Formyl-5-methylphenylboronicacid, 2-Formyl-5-Methylphenylboronic, 2-Formyl-5-methylphenylboronic acid(Contains varying amounts of anhydride)