cas: 5722-93-0 — see every product listed under this CAS number, including other names
2-HYDROXY-4,5-DIMETHOXY BENZOIC ACID, 98%, 98% (CAS 5722-93-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1148K7-250mg |
| cas | 5722-93-0 |
| size | 250mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 174.80 Pln | |
| Chemat | 10g | 246.80 Pln | |
| Chemat | 25g | 448.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-hydroxy-4,5-dimethoxybenzoic acid (CAS 5722-93-0) is a chemical compound with the molecular formula C9H10O5 and a molecular weight of 198.17 g/mol. IUPAC name: 2-hydroxy-4,5-dimethoxybenzoic acid. InChIKey: RUBXSZYVSFYJQR-UHFFFAOYSA-N.
| Molecular formula | C9H10O5 |
|---|---|
| Molecular weight | 198.17 g/mol |
| IUPAC name | 2-hydroxy-4,5-dimethoxybenzoic acid |
| InChIKey | RUBXSZYVSFYJQR-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)C(=O)O)O)OC |
Computed by PubChem (NCBI)