cas: 5722-93-0 — see every product listed under this CAS number, including other names
2-Hydroxy-4,5-dimethoxybenzoic acid, 95% (CAS 5722-93-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F228924-5G |
| cas | 5722-93-0 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 107.27 Pln | |
| Fluorochem | 1g | 107.27 Pln | |
| Fluorochem | 10g | 128.10 Pln | |
| Fluorochem | 25g | 216.61 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
2-hydroxy-4,5-dimethoxybenzoic acid (CAS 5722-93-0) is a chemical compound with the molecular formula C9H10O5 and a molecular weight of 198.17 g/mol. IUPAC name: 2-hydroxy-4,5-dimethoxybenzoic acid. InChIKey: RUBXSZYVSFYJQR-UHFFFAOYSA-N.
| Molecular formula | C9H10O5 |
|---|---|
| Molecular weight | 198.17 g/mol |
| IUPAC name | 2-hydroxy-4,5-dimethoxybenzoic acid |
| InChIKey | RUBXSZYVSFYJQR-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)C(=O)O)O)OC |
Computed by PubChem (NCBI)