cas: 39515-47-4 — see every product listed under this CAS number, including other names
2-Hydroxy-2-(3-phenoxyphenyl)acetonitrile, 95% (CAS 39515-47-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F242234-100MG |
| cas | 39515-47-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 404.04 Pln | |
| Fluorochem | 250mg | 570.65 Pln | |
| Fluorochem | 1g | 1070.47 Pln | |
| Fluorochem | 5g | 3923.64 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
2-hydroxy-2-(3-phenoxyphenyl)acetonitrile (CAS 39515-47-4) is a chemical compound with the molecular formula C14H11NO2 and a molecular weight of 225.24 g/mol. IUPAC name: 2-hydroxy-2-(3-phenoxyphenyl)acetonitrile. InChIKey: GXUQMKBQDGPMKZ-UHFFFAOYSA-N.
| Molecular formula | C14H11NO2 |
|---|---|
| Molecular weight | 225.24 g/mol |
| IUPAC name | 2-hydroxy-2-(3-phenoxyphenyl)acetonitrile |
| InChIKey | GXUQMKBQDGPMKZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC=CC(=C2)C(C#N)O |
Computed by PubChem (NCBI)