cas: 497959-31-6 — see every product listed under this CAS number, including other names
2-Hydroxy-3-(trifluoromethoxy)benzaldehyde 98% (CAS 497959-31-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A733300-100mg |
| cas | 497959-31-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 181.25 Pln | |
| Ambeed | 250mg | 225.75 Pln | |
| Ambeed | 1g | 476.06 Pln | |
| Ambeed | 5g | 2083.62 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A733300 |
2-hydroxy-3-(trifluoromethoxy)benzaldehyde (CAS 497959-31-6) is a chemical compound with the molecular formula C8H5F3O3 and a molecular weight of 206.12 g/mol. IUPAC name: 2-hydroxy-3-(trifluoromethoxy)benzaldehyde. InChIKey: QKIITUNJEPEAIC-UHFFFAOYSA-N.
| Molecular formula | C8H5F3O3 |
|---|---|
| Molecular weight | 206.12 g/mol |
| IUPAC name | 2-hydroxy-3-(trifluoromethoxy)benzaldehyde |
| InChIKey | QKIITUNJEPEAIC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)OC(F)(F)F)O)C=O |
Computed by PubChem (NCBI)