cas: 1071156-25-6 — see every product listed under this CAS number, including other names
2-Hydroxy-4-(trifluoromethoxy)benzaldehyde, 98%, 98% (CAS 1071156-25-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HAWP-1g |
| cas | 1071156-25-6 |
| size | 1g |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 1274.00 Pln | |
| Chemat | 100mg | 328.40 Pln | |
| Chemat | 250mg | 510.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-hydroxy-4-(trifluoromethoxy)benzaldehyde (CAS 1071156-25-6) is a chemical compound with the molecular formula C8H5F3O3 and a molecular weight of 206.12 g/mol. IUPAC name: 2-hydroxy-4-(trifluoromethoxy)benzaldehyde. InChIKey: DFFYWNFXELSYRE-UHFFFAOYSA-N.
| Molecular formula | C8H5F3O3 |
|---|---|
| Molecular weight | 206.12 g/mol |
| IUPAC name | 2-hydroxy-4-(trifluoromethoxy)benzaldehyde |
| InChIKey | DFFYWNFXELSYRE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1OC(F)(F)F)O)C=O |
Computed by PubChem (NCBI)