cas: 85633-41-6 — see every product listed under this CAS number, including other names
2-Hydroxy-5-(pyridin-3-yl)benzaldehyde, 95%, 95% (CAS 85633-41-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11GL11-100mg |
| cas | 85633-41-6 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 472.40 Pln | |
| Chemat | 250mg | 683.60 Pln | |
| Chemat | 1g | 1797.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-hydroxy-5-pyridin-3-ylbenzaldehyde (CAS 85633-41-6) is a chemical compound with the molecular formula C12H9NO2 and a molecular weight of 199.20 g/mol. IUPAC name: 2-hydroxy-5-pyridin-3-ylbenzaldehyde. InChIKey: KVOMYFGYEIPWGE-UHFFFAOYSA-N.
| Molecular formula | C12H9NO2 |
|---|---|
| Molecular weight | 199.20 g/mol |
| IUPAC name | 2-hydroxy-5-pyridin-3-ylbenzaldehyde |
| InChIKey | KVOMYFGYEIPWGE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)C2=CC(=C(C=C2)O)C=O |
Computed by PubChem (NCBI)