CAS 3468-53-9 is the registry number for Phenyl nicotinate, 98%. Offered by: Combi-blocks, Chemat Brand. Available pack sizes: 1g, 25g, 100g, 5g, on request.
Phenyl pyridine-3-carboxylate (CAS 3468-53-9) is a chemical compound with the molecular formula C12H9NO2 and a molecular weight of 199.20 g/mol. IUPAC name: phenyl pyridine-3-carboxylate. InChIKey: QEJPOSAIULNDLU-UHFFFAOYSA-N.
| Molecular formula | C12H9NO2 |
|---|---|
| Molecular weight | 199.20 g/mol |
| IUPAC name | phenyl pyridine-3-carboxylate |
| InChIKey | QEJPOSAIULNDLU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC(=O)C2=CN=CC=C2 |
Computed by PubChem (NCBI)