cas: 123990-78-3 — see every product listed under this CAS number, including other names
2-Hydroxy-6-methoxyquinoline-3-carbaldehyde, 97%, 97% (CAS 123990-78-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111LC6-100mg |
| cas | 123990-78-3 |
| size | 100mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 290.00 Pln | |
| Chemat | 250mg | 453.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
6-methoxy-2-oxo-1H-quinoline-3-carbaldehyde (CAS 123990-78-3) is a chemical compound with the molecular formula C11H9NO3 and a molecular weight of 203.19 g/mol. IUPAC name: 6-methoxy-2-oxo-1H-quinoline-3-carbaldehyde. InChIKey: CUYFVLXHUGFIPJ-UHFFFAOYSA-N.
| Molecular formula | C11H9NO3 |
|---|---|
| Molecular weight | 203.19 g/mol |
| IUPAC name | 6-methoxy-2-oxo-1H-quinoline-3-carbaldehyde |
| InChIKey | CUYFVLXHUGFIPJ-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)NC(=O)C(=C2)C=O |
Computed by PubChem (NCBI)