cas: 81502-74-1 — see every product listed under this CAS number, including other names
2-Hydroxybenzene-1,3,5-tricarbaldehyde 95% (CAS 81502-74-1) is a chemical reagent available from Chemat. Available pack sizes: 100g, 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A954938-100g |
| cas | 81502-74-1 |
| size | 100g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100g | 9270.38 Pln | |
| Ambeed | 100mg | 136.75 Pln | |
| Ambeed | 250mg | 153.44 Pln | |
| Ambeed | 1g | 275.81 Pln | |
| Ambeed | 5g | 654.06 Pln | |
| Ambeed | 10g | 1221.44 Pln | |
| Ambeed | 25g | 2945.81 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A954938 |
2-hydroxybenzene-1,3,5-tricarbaldehyde (CAS 81502-74-1) is a chemical compound with the molecular formula C9H6O4 and a molecular weight of 178.14 g/mol. IUPAC name: 2-hydroxybenzene-1,3,5-tricarbaldehyde. InChIKey: HKAZHQGKWVMFHP-UHFFFAOYSA-N.
| Molecular formula | C9H6O4 |
|---|---|
| Molecular weight | 178.14 g/mol |
| IUPAC name | 2-hydroxybenzene-1,3,5-tricarbaldehyde |
| InChIKey | HKAZHQGKWVMFHP-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C=O)O)C=O)C=O |
Computed by PubChem (NCBI)