cas: 636-94-2 — see every product listed under this CAS number, including other names
2-Hydroxyterephthalic acid 97% (CAS 636-94-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A167506-100mg |
| cas | 636-94-2 |
| size | 100mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 120.06 Pln | |
| Ambeed | 250mg | 131.19 Pln | |
| Ambeed | 1g | 147.88 Pln | |
| Ambeed | 5g | 181.25 Pln | |
| Ambeed | 10g | 248.00 Pln | |
| Ambeed | 25g | 487.19 Pln | |
| Ambeed | 100g | 1521.81 Pln | |
| Ambeed | 500g | 5671.44 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A167506 |
2-hydroxyterephthalic acid (CAS 636-94-2) is a chemical compound with the molecular formula C8H6O5 and a molecular weight of 182.13 g/mol. IUPAC name: 2-hydroxyterephthalic acid. InChIKey: CDOWNLMZVKJRSC-UHFFFAOYSA-N.
| Molecular formula | C8H6O5 |
|---|---|
| Molecular weight | 182.13 g/mol |
| IUPAC name | 2-hydroxyterephthalic acid |
| InChIKey | CDOWNLMZVKJRSC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)O)C(=O)O |
Computed by PubChem (NCBI)