CAS 636-94-2 appears in our catalog under these names: 2-Hydroxyterephthalic acid, 2–Hydroxyterephthalic acid, 2-Hydroxyterephthalic acid 97%, 2-HYDROXYTEREPHTHALIC ACID, 97%, 2-Hydroxyterephthalic Acid, >98.0%(HPLC)(T). Offered by: Dr. Ehrenstorfer, GLPBio, Ambeed, Sigma-Aldrich, Fluorochem. Available pack sizes: 100mg, 25g, 5g, 250mg, 1g, 10g, 100g, 500g.
2-hydroxyterephthalic acid (CAS 636-94-2) is a chemical compound with the molecular formula C8H6O5 and a molecular weight of 182.13 g/mol. IUPAC name: 2-hydroxyterephthalic acid. InChIKey: CDOWNLMZVKJRSC-UHFFFAOYSA-N.
| Molecular formula | C8H6O5 |
|---|---|
| Molecular weight | 182.13 g/mol |
| IUPAC name | 2-hydroxyterephthalic acid |
| InChIKey | CDOWNLMZVKJRSC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)O)C(=O)O |
Computed by PubChem (NCBI)