CAS 127898-52-6 is the registry number for 3-Formyl-4,5-dihydroxybenzoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-formyl-4,5-dihydroxybenzoic acid (CAS 127898-52-6) is a chemical compound with the molecular formula C8H6O5 and a molecular weight of 182.13 g/mol. IUPAC name: 3-formyl-4,5-dihydroxybenzoic acid. InChIKey: APVIGWISCMXNLA-UHFFFAOYSA-N.
| Molecular formula | C8H6O5 |
|---|---|
| Molecular weight | 182.13 g/mol |
| IUPAC name | 3-formyl-4,5-dihydroxybenzoic acid |
| InChIKey | APVIGWISCMXNLA-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C=O)O)O)C(=O)O |
Computed by PubChem (NCBI)