Products 127898-52-6

CAS 127898-52-6 is the registry number for 3-Formyl-4,5-dihydroxybenzoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-formyl-4,5-dihydroxybenzoic acid (CAS 127898-52-6) is a chemical compound with the molecular formula C8H6O5 and a molecular weight of 182.13 g/mol. IUPAC name: 3-formyl-4,5-dihydroxybenzoic acid. InChIKey: APVIGWISCMXNLA-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6O5
Molecular weight182.13 g/mol
IUPAC name3-formyl-4,5-dihydroxybenzoic acid
InChIKeyAPVIGWISCMXNLA-UHFFFAOYSA-N
SMILESC1=C(C=C(C(=C1C=O)O)O)C(=O)O

Computed by PubChem (NCBI)