CAS 22231-81-8 is the registry number for 6-Formyl-2,3-dihydroxybenzoic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
6-formyl-2,3-dihydroxybenzoic acid (CAS 22231-81-8) is a chemical compound with the molecular formula C8H6O5 and a molecular weight of 182.13 g/mol. IUPAC name: 6-formyl-2,3-dihydroxybenzoic acid. InChIKey: ZHZXXNUWCUEKIU-UHFFFAOYSA-N.
| Molecular formula | C8H6O5 |
|---|---|
| Molecular weight | 182.13 g/mol |
| IUPAC name | 6-formyl-2,3-dihydroxybenzoic acid |
| InChIKey | ZHZXXNUWCUEKIU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C=O)C(=O)O)O)O |
Computed by PubChem (NCBI)