Products 22231-81-8

CAS 22231-81-8 is the registry number for 6-Formyl-2,3-dihydroxybenzoic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

6-formyl-2,3-dihydroxybenzoic acid (CAS 22231-81-8) is a chemical compound with the molecular formula C8H6O5 and a molecular weight of 182.13 g/mol. IUPAC name: 6-formyl-2,3-dihydroxybenzoic acid. InChIKey: ZHZXXNUWCUEKIU-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6O5
Molecular weight182.13 g/mol
IUPAC name6-formyl-2,3-dihydroxybenzoic acid
InChIKeyZHZXXNUWCUEKIU-UHFFFAOYSA-N
SMILESC1=CC(=C(C(=C1C=O)C(=O)O)O)O

Computed by PubChem (NCBI)