CAS 16790-41-3 is the registry number for Phloroglucinol Impurity 50. Offered by: Chemat Brand. Available pack sizes: on request.
3,4,5-trihydroxyphthalaldehyde (CAS 16790-41-3) is a chemical compound with the molecular formula C8H6O5 and a molecular weight of 182.13 g/mol. IUPAC name: 3,4,5-trihydroxyphthalaldehyde. InChIKey: BSOXVRQPIPFIDU-UHFFFAOYSA-N.
| Molecular formula | C8H6O5 |
|---|---|
| Molecular weight | 182.13 g/mol |
| IUPAC name | 3,4,5-trihydroxyphthalaldehyde |
| InChIKey | BSOXVRQPIPFIDU-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1O)O)O)C=O)C=O |
Computed by PubChem (NCBI)