cas: 608534-44-7 — see every product listed under this CAS number, including other names
2-Indanylboronic acid pinacol ester 98+% (CAS 608534-44-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A217642-100mg |
| cas | 608534-44-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 281.38 Pln | |
| Ambeed | 250mg | 359.25 Pln | |
| Ambeed | 1g | 882.12 Pln | |
| Ambeed | 5g | 2923.56 Pln | |
| Ambeed | 25g | 9759.88 Pln | |
| Ambeed | 100g | 33650.81 Pln |
| purity | 98+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A217642 |
2-(2,3-dihydro-1H-inden-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 608534-44-7) is a chemical compound with the molecular formula C15H21BO2 and a molecular weight of 244.14 g/mol. IUPAC name: 2-(2,3-dihydro-1H-inden-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: YRTKSYXHFWUPAZ-UHFFFAOYSA-N.
| Molecular formula | C15H21BO2 |
|---|---|
| Molecular weight | 244.14 g/mol |
| IUPAC name | 2-(2,3-dihydro-1H-inden-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | YRTKSYXHFWUPAZ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2CC3=CC=CC=C3C2 |
Computed by PubChem (NCBI)