cas: 1001907-58-9 — see every product listed under this CAS number, including other names
2-METHYLINDAZOLE-7-BORONIC ACID, 95% (CAS 1001907-58-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F501921-100MG |
| cas | 1001907-58-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 508.17 Pln | |
| Fluorochem | 250mg | 841.39 Pln | |
| Fluorochem | 1g | 2018.06 Pln | |
| Fluorochem | 5g | 8151.31 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
(2-methylindazol-7-yl)boronic acid (CAS 1001907-58-9) is a chemical compound with the molecular formula C8H9BN2O2 and a molecular weight of 175.98 g/mol. IUPAC name: (2-methylindazol-7-yl)boronic acid. InChIKey: PNVSRHLDCRSFAZ-UHFFFAOYSA-N.
| Molecular formula | C8H9BN2O2 |
|---|---|
| Molecular weight | 175.98 g/mol |
| IUPAC name | (2-methylindazol-7-yl)boronic acid |
| InChIKey | PNVSRHLDCRSFAZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC=CC2=CN(N=C12)C)(O)O |
Computed by PubChem (NCBI)