CAS 1034449-18-7 appears in our catalog under these names: 2-MESITYL-5-METHYLIMIDAZO(1,5-A)PYRIDIN&, 2-Mesityl-5-methylimidazo[1,5-a]pyridinium chloride, 97%, 97%, 2-Mesityl-5-methyl-2H-imidazo[1,5-a]pyridin-4-ium chloride, 97%. Offered by: Sigma-Aldrich, Chemat, Ambeed. Available pack sizes: 250MG, 100mg, 1g, 5g.
5-methyl-2-(2,4,6-trimethylphenyl)imidazo[1,5-a]pyridin-2-ium chloride (CAS 1034449-18-7) is a chemical compound with the molecular formula C17H19ClN2 and a molecular weight of 286.8 g/mol. IUPAC name: 5-methyl-2-(2,4,6-trimethylphenyl)imidazo[1,5-a]pyridin-2-ium chloride. InChIKey: DJFXURXZOPNPGY-UHFFFAOYSA-M.
| Molecular formula | C17H19ClN2 |
|---|---|
| Molecular weight | 286.8 g/mol |
| IUPAC name | 5-methyl-2-(2,4,6-trimethylphenyl)imidazo[1,5-a]pyridin-2-ium chloride |
| InChIKey | DJFXURXZOPNPGY-UHFFFAOYSA-M |
| SMILES | CC1=CC=CC2=C[N+](=CN12)C3=C(C=C(C=C3C)C)C.[Cl-] |
Computed by PubChem (NCBI)