CAS 1221174-11-3 is the registry number for rel-(3R,4S)-1-Benzyl-4-(3-chlorophenyl)pyrrolidin-3-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3R,4S)-1-benzyl-4-(3-chlorophenyl)pyrrolidin-3-amine (CAS 1221174-11-3) is a chemical compound with the molecular formula C17H19ClN2 and a molecular weight of 286.8 g/mol. IUPAC name: (3R,4S)-1-benzyl-4-(3-chlorophenyl)pyrrolidin-3-amine. InChIKey: GAWLXZAVCBXWGC-SJORKVTESA-N.
| Molecular formula | C17H19ClN2 |
|---|---|
| Molecular weight | 286.8 g/mol |
| IUPAC name | (3R,4S)-1-benzyl-4-(3-chlorophenyl)pyrrolidin-3-amine |
| InChIKey | GAWLXZAVCBXWGC-SJORKVTESA-N |
| SMILES | C1[C@@H]([C@H](CN1CC2=CC=CC=C2)N)C3=CC(=CC=C3)Cl |
Computed by PubChem (NCBI)