CAS 70558-10-0 appears in our catalog under these names: Levocetirizine Impurity 4, Cetirizine Impurity 32. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
1-[(3-chlorophenyl)-phenylmethyl]piperazine (CAS 70558-10-0) is a chemical compound with the molecular formula C17H19ClN2 and a molecular weight of 286.8 g/mol. IUPAC name: 1-[(3-chlorophenyl)-phenylmethyl]piperazine. InChIKey: UGTBQURRNOQZSV-UHFFFAOYSA-N.
| Molecular formula | C17H19ClN2 |
|---|---|
| Molecular weight | 286.8 g/mol |
| IUPAC name | 1-[(3-chlorophenyl)-phenylmethyl]piperazine |
| InChIKey | UGTBQURRNOQZSV-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C(C2=CC=CC=C2)C3=CC(=CC=C3)Cl |
Computed by PubChem (NCBI)