CAS 76134-77-5 appears in our catalog under these names: Mianserin EP Impurity E HCl, Mianserin hydrochloride EP Impurity E, Nor Mianserin Hydrochloride, >95% (HPLC), Normianserin Hydrochloride 1.0 mg/ml in Methanol (as free base), 1,2,3,4,10,14b-hexahydrodibenzo[c,f]pyrazino[1,2-a]azepine hydrochloride, 95%, 95%. Offered by: Chemat Brand, TRC, LoGiCal, Chemat. Available pack sizes: on request, 50mg, 5mg, 1ml, 10mg.
2,5-diazatetracyclo[13.4.0.02,7.08,13]nonadeca-1(19),8,10,12,15,17-hexaene;hydrochloride (CAS 76134-77-5) is a chemical compound with the molecular formula C17H19ClN2 and a molecular weight of 286.8 g/mol. IUPAC name: 2,5-diazatetracyclo[13.4.0.02,7.08,13]nonadeca-1(19),8,10,12,15,17-hexaene;hydrochloride. InChIKey: KVJGBZBVKLKGRN-UHFFFAOYSA-N.
| Molecular formula | C17H19ClN2 |
|---|---|
| Molecular weight | 286.8 g/mol |
| IUPAC name | 2,5-diazatetracyclo[13.4.0.02,7.08,13]nonadeca-1(19),8,10,12,15,17-hexaene;hydrochloride |
| InChIKey | KVJGBZBVKLKGRN-UHFFFAOYSA-N |
| SMILES | C1CN2C(CN1)C3=CC=CC=C3CC4=CC=CC=C42.Cl |
Computed by PubChem (NCBI)