Products 791026-42-1
CAS 791026-42-1 is the registry number for Delfaprazine Impurity 1. Offered by: Chemat Brand. Available pack sizes: on request.
1-(2-benzyl-4-chlorophenyl)piperazine (CAS 791026-42-1) is a chemical compound with the molecular formula C17H19ClN2 and a molecular weight of 286.8 g/mol. IUPAC name: 1-(2-benzyl-4-chlorophenyl)piperazine. InChIKey: PLJNNQBEGNOIIV-UHFFFAOYSA-N.
| Molecular formula | C17H19ClN2 |
|---|---|
| Molecular weight | 286.8 g/mol |
| IUPAC name | 1-(2-benzyl-4-chlorophenyl)piperazine |
| InChIKey | PLJNNQBEGNOIIV-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=C(C=C(C=C2)Cl)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)