cas: 1820707-92-3 — see every product listed under this CAS number, including other names
2-Methanesulfonylpyridine-4-carboxamide, 97%, 97% (CAS 1820707-92-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I1ZB-100mg |
| cas | 1820707-92-3 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 410.00 Pln | |
| Chemat | 250mg | 650.00 Pln | |
| Chemat | 1g | 1240.40 Pln | |
| Chemat | 5g | 4773.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-methylsulfonylpyridine-4-carboxamide (CAS 1820707-92-3) is a chemical compound with the molecular formula C7H8N2O3S and a molecular weight of 200.22 g/mol. IUPAC name: 2-methylsulfonylpyridine-4-carboxamide. InChIKey: MVLQDOUUZWWRRP-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O3S |
|---|---|
| Molecular weight | 200.22 g/mol |
| IUPAC name | 2-methylsulfonylpyridine-4-carboxamide |
| InChIKey | MVLQDOUUZWWRRP-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=NC=CC(=C1)C(=O)N |
Computed by PubChem (NCBI)