CAS 2365418-48-8 is the registry number for 6-Methanesulfonylpyridine-2-carboxamide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
6-methylsulfonylpyridine-2-carboxamide (CAS 2365418-48-8) is a chemical compound with the molecular formula C7H8N2O3S and a molecular weight of 200.22 g/mol. IUPAC name: 6-methylsulfonylpyridine-2-carboxamide. InChIKey: HXQWMTHLDOCJMN-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O3S |
|---|---|
| Molecular weight | 200.22 g/mol |
| IUPAC name | 6-methylsulfonylpyridine-2-carboxamide |
| InChIKey | HXQWMTHLDOCJMN-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC=CC(=N1)C(=O)N |
Computed by PubChem (NCBI)