Products 19692-00-3
CAS 19692-00-3 appears in our catalog under these names: 4-Oxo-4-(1,3-thiazol-2-ylamino)butanoic acid, 95%, 4-Oxo-4-(thiazol-2-ylamino)butanoic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
4-oxo-4-(1,3-thiazol-2-ylamino)butanoic acid (CAS 19692-00-3) is a chemical compound with the molecular formula C7H8N2O3S and a molecular weight of 200.22 g/mol. IUPAC name: 4-oxo-4-(1,3-thiazol-2-ylamino)butanoic acid. InChIKey: SVMGZMBKMJRZLI-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O3S |
|---|---|
| Molecular weight | 200.22 g/mol |
| IUPAC name | 4-oxo-4-(1,3-thiazol-2-ylamino)butanoic acid |
| InChIKey | SVMGZMBKMJRZLI-UHFFFAOYSA-N |
| SMILES | C1=CSC(=N1)NC(=O)CCC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
3-[(1,3-thiazol-2-yl)carbamoyl]propanoic acid, N-Thiazol-2-yl-succinamic acid, 4-oxo-4-(thiazol-2-ylamino)butanoic acid, 4-oxo-4-(1,3-thiazol-2-ylamino)butanoic acid, 3-(1,3-thiazol-2-ylcarbamoyl)propanoic acid, 3-(N-(1,3-thiazol-2-yl)carbamoyl)propanoic acid, Oprea1_057043, Oprea1_497240, Oprea1_526854, IFLab1_000192