Products 1174534-36-1

CAS 1174534-36-1 is the registry number for 2-Acetylamino-5-thiazolecarboxylic acid methyl ester, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.

Structural formula: {0} (CAS {1})

Methyl 2-acetamido-1,3-thiazole-5-carboxylate (CAS 1174534-36-1) is a chemical compound with the molecular formula C7H8N2O3S and a molecular weight of 200.22 g/mol. IUPAC name: methyl 2-acetamido-1,3-thiazole-5-carboxylate. InChIKey: BDOCUFPLXVCJIO-UHFFFAOYSA-N.

Identity
Molecular formulaC7H8N2O3S
Molecular weight200.22 g/mol
IUPAC namemethyl 2-acetamido-1,3-thiazole-5-carboxylate
InChIKeyBDOCUFPLXVCJIO-UHFFFAOYSA-N
SMILESCC(=O)NC1=NC=C(S1)C(=O)OC

Computed by PubChem (NCBI)