CAS 1174534-36-1 is the registry number for 2-Acetylamino-5-thiazolecarboxylic acid methyl ester, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
Methyl 2-acetamido-1,3-thiazole-5-carboxylate (CAS 1174534-36-1) is a chemical compound with the molecular formula C7H8N2O3S and a molecular weight of 200.22 g/mol. IUPAC name: methyl 2-acetamido-1,3-thiazole-5-carboxylate. InChIKey: BDOCUFPLXVCJIO-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O3S |
|---|---|
| Molecular weight | 200.22 g/mol |
| IUPAC name | methyl 2-acetamido-1,3-thiazole-5-carboxylate |
| InChIKey | BDOCUFPLXVCJIO-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=NC=C(S1)C(=O)OC |
Computed by PubChem (NCBI)