CAS 63788-62-5 appears in our catalog under these names: 2-Acetylamino-4-methylthiazole-5-carboxylic acid, 95%, 2-Acetylamino-4-methylthiazole-5-carboxylic acid, 97%, 2-Acetylamino-4-methylthiazole-5-carboxylic acid, 97%, 97%, 2-Acetylamino-4-methyl-thiazole-5-carboxylic acid, 95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 10g, 5g.
2-acetamido-4-methyl-1,3-thiazole-5-carboxylic acid (CAS 63788-62-5) is a chemical compound with the molecular formula C7H8N2O3S and a molecular weight of 200.22 g/mol. IUPAC name: 2-acetamido-4-methyl-1,3-thiazole-5-carboxylic acid. InChIKey: QNBIYKNODXVOFV-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O3S |
|---|---|
| Molecular weight | 200.22 g/mol |
| IUPAC name | 2-acetamido-4-methyl-1,3-thiazole-5-carboxylic acid |
| InChIKey | QNBIYKNODXVOFV-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)NC(=O)C)C(=O)O |
Computed by PubChem (NCBI)